CAS 1262046-34-3 appears in our catalog under these names: Rockphos, 98%, Rockpahos, 2–(Di–t–butylphosphino)–3–methoxy–6–methyl–2',4',6'–tri–i–propyl–1,1'–biphenyl, RockPhos 98%, ROCKPHOS CHEMBEADS, 5% WT. LOADING. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 1g, 2,5g, 10g, 50mg, 5g, 2G.
Ditert-butyl-[6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (CAS 1262046-34-3) is a chemical compound with the molecular formula C31H49OP and a molecular weight of 468.7 g/mol. IUPAC name: ditert-butyl-[6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane. InChIKey: CVLLAKCGAFNZHJ-UHFFFAOYSA-N.
| Molecular formula | C31H49OP |
|---|---|
| Molecular weight | 468.7 g/mol |
| IUPAC name | ditert-butyl-[6-methoxy-3-methyl-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| InChIKey | CVLLAKCGAFNZHJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)OC)P(C(C)(C)C)C(C)(C)C)C2=C(C=C(C=C2C(C)C)C(C)C)C(C)C |
Computed by PubChem (NCBI)