CAS 1262324-19-5 is the registry number for Blonanserin Impurity P. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-bis(4-fluorophenyl)pyrimidin-4-amine (CAS 1262324-19-5) is a chemical compound with the molecular formula C16H11F2N3 and a molecular weight of 283.27 g/mol. IUPAC name: 2,6-bis(4-fluorophenyl)pyrimidin-4-amine. InChIKey: IPBAAIXIMKAYLH-UHFFFAOYSA-N.
| Molecular formula | C16H11F2N3 |
|---|---|
| Molecular weight | 283.27 g/mol |
| IUPAC name | 2,6-bis(4-fluorophenyl)pyrimidin-4-amine |
| InChIKey | IPBAAIXIMKAYLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC(=N2)C3=CC=C(C=C3)F)N)F |
Computed by PubChem (NCBI)