CAS 1262398-42-4 is the registry number for 4,5-Dibromo-9H-xanthen-9-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.
4,5-dibromoxanthen-9-one (CAS 1262398-42-4) is a chemical compound with the molecular formula C13H6Br2O2 and a molecular weight of 353.99 g/mol. IUPAC name: 4,5-dibromoxanthen-9-one. InChIKey: JDLRWTVBHCSHDR-UHFFFAOYSA-N.
| Molecular formula | C13H6Br2O2 |
|---|---|
| Molecular weight | 353.99 g/mol |
| IUPAC name | 4,5-dibromoxanthen-9-one |
| InChIKey | JDLRWTVBHCSHDR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)OC3=C(C2=O)C=CC=C3Br |
Computed by PubChem (NCBI)