CAS 1262406-08-5 appears in our catalog under these names: p38α inhibitor 4/ 99.79% (existing batch purity), p38α inhibitor 4. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 25 mg, 100 mg.
4-(trifluoromethyl)-3-[3-(trifluoromethyl)phenyl]-2,7-dihydropyrazolo[3,4-b]pyridin-6-one (CAS 1262406-08-5) is a chemical compound with the molecular formula C14H7F6N3O and a molecular weight of 347.21 g/mol. IUPAC name: 4-(trifluoromethyl)-3-[3-(trifluoromethyl)phenyl]-2,7-dihydropyrazolo[3,4-b]pyridin-6-one. InChIKey: YEINPIKXEQEWSU-UHFFFAOYSA-N.
| Molecular formula | C14H7F6N3O |
|---|---|
| Molecular weight | 347.21 g/mol |
| IUPAC name | 4-(trifluoromethyl)-3-[3-(trifluoromethyl)phenyl]-2,7-dihydropyrazolo[3,4-b]pyridin-6-one |
| InChIKey | YEINPIKXEQEWSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=C3C(=CC(=O)NC3=NN2)C(F)(F)F |
Computed by PubChem (NCBI)