Products 1262410-89-8

CAS 1262410-89-8 is the registry number for 4-Cyanothiane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-cyanothiane-4-carboxylic acid (CAS 1262410-89-8) is a chemical compound with the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. IUPAC name: 4-cyanothiane-4-carboxylic acid. InChIKey: ZOMSHEQZYDAITR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO2S
Molecular weight171.22 g/mol
IUPAC name4-cyanothiane-4-carboxylic acid
InChIKeyZOMSHEQZYDAITR-UHFFFAOYSA-N
SMILESC1CSCCC1(C#N)C(=O)O

Computed by PubChem (NCBI)