CAS 1262412-46-3 is the registry number for 3-(3-Fluorophenyl)-1,2,4-oxadiazole, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
3-(3-fluorophenyl)-1,2,4-oxadiazole (CAS 1262412-46-3) is a chemical compound with the molecular formula C8H5FN2O and a molecular weight of 164.14 g/mol. IUPAC name: 3-(3-fluorophenyl)-1,2,4-oxadiazole. InChIKey: SQHQKHGSNYSZMC-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O |
|---|---|
| Molecular weight | 164.14 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-1,2,4-oxadiazole |
| InChIKey | SQHQKHGSNYSZMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NOC=N2 |
Computed by PubChem (NCBI)