Products 1262414-79-8

CAS 1262414-79-8 is the registry number for Methyl 2-amino-2-(trifluoromethyl)but-3-ynoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-2-(trifluoromethyl)but-3-ynoate (CAS 1262414-79-8) is a chemical compound with the molecular formula C6H6F3NO2 and a molecular weight of 181.11 g/mol. IUPAC name: methyl 2-amino-2-(trifluoromethyl)but-3-ynoate. InChIKey: PASRXXSJNAMYHP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6F3NO2
Molecular weight181.11 g/mol
IUPAC namemethyl 2-amino-2-(trifluoromethyl)but-3-ynoate
InChIKeyPASRXXSJNAMYHP-UHFFFAOYSA-N
SMILESCOC(=O)C(C#C)(C(F)(F)F)N

Computed by PubChem (NCBI)