CAS 1997200-27-7 appears in our catalog under these names: 5-Methyl-5-(trifluoromethyl)pyrrolidine-2,4-dione, 98%, 5-Methyl-5-(trifluoromethyl)pyrrolidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-methyl-5-(trifluoromethyl)pyrrolidine-2,4-dione (CAS 1997200-27-7) is a chemical compound with the molecular formula C6H6F3NO2 and a molecular weight of 181.11 g/mol. IUPAC name: 5-methyl-5-(trifluoromethyl)pyrrolidine-2,4-dione. InChIKey: MKEVIUFGXDOHNQ-UHFFFAOYSA-N.
| Molecular formula | C6H6F3NO2 |
|---|---|
| Molecular weight | 181.11 g/mol |
| IUPAC name | 5-methyl-5-(trifluoromethyl)pyrrolidine-2,4-dione |
| InChIKey | MKEVIUFGXDOHNQ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)CC(=O)N1)C(F)(F)F |
Computed by PubChem (NCBI)