CAS 1262433-88-4 is the registry number for TPB–TP–COF. Offered by: GLPBio. Available pack sizes: 100mg, 500mg.
4-[3,5-bis(4-aminophenyl)phenyl]aniline;terephthalaldehyde (CAS 1262433-88-4) is a chemical compound with the molecular formula C32H27N3O2 and a molecular weight of 485.6 g/mol. IUPAC name: 4-[3,5-bis(4-aminophenyl)phenyl]aniline;terephthalaldehyde. InChIKey: JHUQLLMOTQXHNZ-UHFFFAOYSA-N.
| Molecular formula | C32H27N3O2 |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | 4-[3,5-bis(4-aminophenyl)phenyl]aniline;terephthalaldehyde |
| InChIKey | JHUQLLMOTQXHNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C=O.C1=CC(=CC=C1C2=CC(=CC(=C2)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N)N |
Computed by PubChem (NCBI)