CAS 1262435-15-3 is the registry number for Sodium bicyclo[2,2,1]heptane-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Sodium bicyclo[2.2.1]heptane-2-carboxylate (CAS 1262435-15-3) is a chemical compound with the molecular formula C8H11NaO2 and a molecular weight of 162.16 g/mol. IUPAC name: sodium bicyclo[2.2.1]heptane-2-carboxylate. InChIKey: WVHYWHGOIJEBAT-UHFFFAOYSA-M.
| Molecular formula | C8H11NaO2 |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | sodium bicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | WVHYWHGOIJEBAT-UHFFFAOYSA-M |
| SMILES | C1CC2CC1CC2C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)