CAS 1262583-10-7 appears in our catalog under these names: Memantine Related Compound 3, 1-Nitroso-3,5-dimethyladamantane. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
1,3-dimethyl-5-nitrosoadamantane (CAS 1262583-10-7) is a chemical compound with the molecular formula C12H19NO and a molecular weight of 193.28 g/mol. IUPAC name: 1,3-dimethyl-5-nitrosoadamantane. InChIKey: POHXMTWSWALMTL-UHFFFAOYSA-N.
| Molecular formula | C12H19NO |
|---|---|
| Molecular weight | 193.28 g/mol |
| IUPAC name | 1,3-dimethyl-5-nitrosoadamantane |
| InChIKey | POHXMTWSWALMTL-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)N=O)C |
Computed by PubChem (NCBI)