CAS 1262665-49-5 is the registry number for 2-Bromo-6-(difluoromethoxy)-4-(heptafluoropropan-2-yl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline (CAS 1262665-49-5) is a chemical compound with the molecular formula C10H5BrF9NO and a molecular weight of 406.04 g/mol. IUPAC name: 2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline. InChIKey: MAVMQOJBPKOBEB-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF9NO |
|---|---|
| Molecular weight | 406.04 g/mol |
| IUPAC name | 2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline |
| InChIKey | MAVMQOJBPKOBEB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1OC(F)F)N)Br)C(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)