CAS 1262769-87-8 is the registry number for Isophorone-d5. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
2,4,4,6,6-pentadeuterio-3,5,5-trimethylcyclohex-2-en-1-one (CAS 1262769-87-8) is a chemical compound with the molecular formula C9H14O and a molecular weight of 143.24 g/mol. IUPAC name: 2,4,4,6,6-pentadeuterio-3,5,5-trimethylcyclohex-2-en-1-one. InChIKey: HJOVHMDZYOCNQW-FIFBNPHPSA-N.
| Molecular formula | C9H14O |
|---|---|
| Molecular weight | 143.24 g/mol |
| IUPAC name | 2,4,4,6,6-pentadeuterio-3,5,5-trimethylcyclohex-2-en-1-one |
| InChIKey | HJOVHMDZYOCNQW-FIFBNPHPSA-N |
| SMILES | [2H]C1=C(C(C(C(C1=O)([2H])[2H])(C)C)([2H])[2H])C |
Computed by PubChem (NCBI)