CAS 1262860-81-0 is the registry number for Rel-(2R,5S)-5-(3-bromophenyl)-2,5-dimethyl-2-(trifluoromethyl)morpholin-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5S)-5-(3-bromophenyl)-2,5-dimethyl-2-(trifluoromethyl)morpholin-3-one (CAS 1262860-81-0) is a chemical compound with the molecular formula C13H13BrF3NO2 and a molecular weight of 352.15 g/mol. IUPAC name: (2R,5S)-5-(3-bromophenyl)-2,5-dimethyl-2-(trifluoromethyl)morpholin-3-one. InChIKey: GLYIABYXOARKIR-VXGBXAGGSA-N.
| Molecular formula | C13H13BrF3NO2 |
|---|---|
| Molecular weight | 352.15 g/mol |
| IUPAC name | (2R,5S)-5-(3-bromophenyl)-2,5-dimethyl-2-(trifluoromethyl)morpholin-3-one |
| InChIKey | GLYIABYXOARKIR-VXGBXAGGSA-N |
| SMILES | C[C@@]1(CO[C@@](C(=O)N1)(C)C(F)(F)F)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)