CAS 1262888-28-7 appears in our catalog under these names: Spautin-1/ 98.99% (existing batch purity), Spautin–1, Spautin-1, >98.0%(GC)(T), Spautin-1 98%, Spautin-1 1PC X 10MG. Offered by: TargetMol, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
6-fluoro-N-[(4-fluorophenyl)methyl]quinazolin-4-amine (CAS 1262888-28-7) is a chemical compound with the molecular formula C15H11F2N3 and a molecular weight of 271.26 g/mol. IUPAC name: 6-fluoro-N-[(4-fluorophenyl)methyl]quinazolin-4-amine. InChIKey: AWIVHRPYFSSVOG-UHFFFAOYSA-N.
| Molecular formula | C15H11F2N3 |
|---|---|
| Molecular weight | 271.26 g/mol |
| IUPAC name | 6-fluoro-N-[(4-fluorophenyl)methyl]quinazolin-4-amine |
| InChIKey | AWIVHRPYFSSVOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=NC=NC3=C2C=C(C=C3)F)F |
Computed by PubChem (NCBI)