CAS 1263-63-4 appears in our catalog under these names: Mesoporphyrin ix dimethyl ester, 95%, Mesoporphyrin IX dimethylester, MESOPORPHYRIN IX DIMETHYL ESTER, SYNTHET, Mesoporphyrin IX dimethyl ester, Mesoporphyrin dimethyl ester. Offered by: Combi-blocks, Biosynth, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 5000mg, 25 mg, 50 mg, 100 mg.
Methyl 3-[8,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (CAS 1263-63-4) is a chemical compound with the molecular formula C36H42N4O4 and a molecular weight of 594.7 g/mol. IUPAC name: methyl 3-[8,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate. InChIKey: CQKDGYMHYLBWTQ-UHFFFAOYSA-N.
| Molecular formula | C36H42N4O4 |
|---|---|
| Molecular weight | 594.7 g/mol |
| IUPAC name | methyl 3-[8,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| InChIKey | CQKDGYMHYLBWTQ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC3=C(C(=C(N3)C=C4C(=C(C(=N4)C=C5C(=C(C(=N5)C=C1N2)C)CCC(=O)OC)CCC(=O)OC)C)C)CC)C |
Computed by PubChem (NCBI)