CAS 1263044-40-1 appears in our catalog under these names: Biotin-PEG3-OH/ 98.79% (existing batch purity), Biotin–PEG3–OH, Biotin-PEG3-OH 95%, Biotin-PEG3-OH, 95%, 95%, Biotin-PEG3-OH, 98.00%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g, 100 mg.
N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (CAS 1263044-40-1) is a chemical compound with the molecular formula C16H29N3O5S and a molecular weight of 375.5 g/mol. IUPAC name: N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide. InChIKey: JMPJDHGWKSPEEE-UHFFFAOYSA-N.
| Molecular formula | C16H29N3O5S |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| InChIKey | JMPJDHGWKSPEEE-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCO)NC(=O)N2 |
Computed by PubChem (NCBI)