CAS 1263045-12-0 appears in our catalog under these names: 4-[(Boc)2-guanidino]phenylacetic acid, 95%, 4-((Boc)2-guanidino)phenylacetic acid, 97%, (Boc)2-4-GPAc-OH. Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 5g, 1g, 250mg, 25g, 500mg.
2-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]acetic acid (CAS 1263045-12-0) is a chemical compound with the molecular formula C19H27N3O6 and a molecular weight of 393.4 g/mol. IUPAC name: 2-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]acetic acid. InChIKey: NSLPHFNMIHNLKV-UHFFFAOYSA-N.
| Molecular formula | C19H27N3O6 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | 2-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]acetic acid |
| InChIKey | NSLPHFNMIHNLKV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(=NC1=CC=C(C=C1)CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)