CAS 1263045-16-4 appears in our catalog under these names: mal-PEG(4)-COOH, MAL-dPEG®,4-Acid, 3-Amino(peg4)propionic acid 3-maleimidopropionamide, 95%, Mal–amido–PEG4–acid, 19-Maleimido-17-oxo-4,7,10,13-tetraoxa-16-azanonadecanoic Acid, >95.0%(HPLC). Offered by: Iris Biotech, Biosynth, Combi-blocks, GLPBio, TCI. Available pack sizes: 1g, 100mg, 1000mg, 0,1g, 5g, 250mg, 25mg, 10g.
3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1263045-16-4) is a chemical compound with the molecular formula C18H28N2O9 and a molecular weight of 416.4 g/mol. IUPAC name: 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: IAJVEYLYYHOZEY-UHFFFAOYSA-N.
| Molecular formula | C18H28N2O9 |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | IAJVEYLYYHOZEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)