CAS 1263047-17-1 appears in our catalog under these names: 2-BOC-Hydrozino 3-amino(peg4)propionamide, 95%, Amino–PEG4–hydrazide–Boc, H2N-PEG(4)-NHNH-Boc, H2N-DPEG(4)-NHNH-Boc, Amino-dPEG®,4-t-boc-hydrazide. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 500mg, 100mg, 1g, 1000mg, 250mg, 5g, 100 mg, 1 g.
Tert-butyl N-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]carbamate (CAS 1263047-17-1) is a chemical compound with the molecular formula C16H33N3O7 and a molecular weight of 379.45 g/mol. IUPAC name: tert-butyl N-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]carbamate. InChIKey: SJCNXVBYQPAENC-UHFFFAOYSA-N.
| Molecular formula | C16H33N3O7 |
|---|---|
| Molecular weight | 379.45 g/mol |
| IUPAC name | tert-butyl N-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]carbamate |
| InChIKey | SJCNXVBYQPAENC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNC(=O)CCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)