Products 1263058-69-0
CAS 1263058-69-0 appears in our catalog under these names: 3-Bromo-6-fluoro-2-methylimidazo[1,2-a]pyridine, 95%, 3-Bromo-6-fluoro-2-methylimidazo(1,2-a)pyridine, 97%, 3-Bromo-6-fluoro-2-methylimidazo[1,2-a]pyridine, 97%, 97%, 3-BROMO-6-FLUORO-2-METHYLIMIDAZO[1,2-A]PYRIDINE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-bromo-6-fluoro-2-methylimidazo[1,2-a]pyridine (CAS 1263058-69-0) is a chemical compound with the molecular formula C8H6BrFN2 and a molecular weight of 229.05 g/mol. IUPAC name: 3-bromo-6-fluoro-2-methylimidazo[1,2-a]pyridine. InChIKey: XBMXNCTYBBEBTR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFN2 |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 3-bromo-6-fluoro-2-methylimidazo[1,2-a]pyridine |
| InChIKey | XBMXNCTYBBEBTR-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=C(C=CC2=N1)F)Br |
Computed by PubChem (NCBI)