CAS 1263094-00-3 appears in our catalog under these names: 7-Chlorokynurenic acid sodium salt, 98%, 7-Chlorokynurenic acid sodium salt, 7–Chlorokynurenic acid sodium salt, 7-Chlorokynurenic acid (sodium salt), ≥98%, ≥98%, 7-Chlorokynurenic acid (sodium salt), 99.89%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 2mg, 10mg, 50mg, 5mg, 25mg.
Sodium 7-chloro-4-oxo-1H-quinoline-2-carboxylate (CAS 1263094-00-3) is a chemical compound with the molecular formula C10H5ClNNaO3 and a molecular weight of 245.59 g/mol. IUPAC name: sodium 7-chloro-4-oxo-1H-quinoline-2-carboxylate. InChIKey: IFZYIORLNGNLEI-UHFFFAOYSA-M.
| Molecular formula | C10H5ClNNaO3 |
|---|---|
| Molecular weight | 245.59 g/mol |
| IUPAC name | sodium 7-chloro-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | IFZYIORLNGNLEI-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C=C1Cl)NC(=CC2=O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)