CAS 1263094-24-1 is the registry number for 3-(3-Phenyl-1h-1,2,4-triazol-5-yl)piperidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidine;hydrochloride (CAS 1263094-24-1) is a chemical compound with the molecular formula C13H17ClN4 and a molecular weight of 264.75 g/mol. IUPAC name: 3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidine;hydrochloride. InChIKey: CUZOHNYLBMCODJ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN4 |
|---|---|
| Molecular weight | 264.75 g/mol |
| IUPAC name | 3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidine;hydrochloride |
| InChIKey | CUZOHNYLBMCODJ-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=NC(=NN2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)