Products 126312-61-6

CAS 126312-61-6 is the registry number for 5-(Benzyloxy)-2-iodo-1,3-dimethylbenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-iodo-1,3-dimethyl-5-phenylmethoxybenzene (CAS 126312-61-6) is a chemical compound with the molecular formula C15H15IO and a molecular weight of 338.18 g/mol. IUPAC name: 2-iodo-1,3-dimethyl-5-phenylmethoxybenzene. InChIKey: ICHZYYGVAKLSCT-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15IO
Molecular weight338.18 g/mol
IUPAC name2-iodo-1,3-dimethyl-5-phenylmethoxybenzene
InChIKeyICHZYYGVAKLSCT-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1I)C)OCC2=CC=CC=C2

Computed by PubChem (NCBI)