CAS 1263131-92-5 appears in our catalog under these names: MRT–83, MRT-83, MRT-83/ 99.92% (existing batch purity), MRT-83, 99.27%, MRT-83, 98%, 98%. Offered by: GLPBio, TRC, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 5mg, 50mg, 2mg, 10mg, 25mg, 100mg, 200mg, 5 mg.
3,4,5-trimethoxy-N-[N'-[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamimidoyl]benzamide (CAS 1263131-92-5) is a chemical compound with the molecular formula C31H30N4O5 and a molecular weight of 538.6 g/mol. IUPAC name: 3,4,5-trimethoxy-N-[N'-[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamimidoyl]benzamide. InChIKey: BKTMNLKJWHVZRN-UHFFFAOYSA-N.
| Molecular formula | C31H30N4O5 |
|---|---|
| Molecular weight | 538.6 g/mol |
| IUPAC name | 3,4,5-trimethoxy-N-[N'-[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamimidoyl]benzamide |
| InChIKey | BKTMNLKJWHVZRN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N=C(N)NC(=O)C2=CC(=C(C(=C2)OC)OC)OC)NC(=O)C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)