CAS 1263178-53-5 appears in our catalog under these names: (2-Amino-5-fluorophenyl)dimethylphosphine oxide, (2-Amino-5-fluorophenyl)dimethylphosphine oxide 98%, (2-Amino-5-fluorophenyl)dimethylphosphine oxide, 97%, (2-Amino-5-fluorophenyl)dimethylphosphine oxide, 98%, 98%. Offered by: TRC, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 100mg, 1g.
2-dimethylphosphoryl-4-fluoroaniline (CAS 1263178-53-5) is a chemical compound with the molecular formula C8H11FNOP and a molecular weight of 187.15 g/mol. IUPAC name: 2-dimethylphosphoryl-4-fluoroaniline. InChIKey: KKDZPJAROYVZPM-UHFFFAOYSA-N.
| Molecular formula | C8H11FNOP |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 2-dimethylphosphoryl-4-fluoroaniline |
| InChIKey | KKDZPJAROYVZPM-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=C(C=CC(=C1)F)N |
Computed by PubChem (NCBI)