Products 1263180-54-6

CAS 1263180-54-6 is the registry number for 4-Chloro-[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-chloro-[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid (CAS 1263180-54-6) is a chemical compound with the molecular formula C10H5ClN4O2 and a molecular weight of 248.62 g/mol. IUPAC name: 4-chloro-[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid. InChIKey: WOZBIMTXLAYVPU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5ClN4O2
Molecular weight248.62 g/mol
IUPAC name4-chloro-[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid
InChIKeyWOZBIMTXLAYVPU-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)N=C(C3=NC(=NN23)C(=O)O)Cl

Computed by PubChem (NCBI)