CAS 1263180-54-6 is the registry number for 4-Chloro-[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-chloro-[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid (CAS 1263180-54-6) is a chemical compound with the molecular formula C10H5ClN4O2 and a molecular weight of 248.62 g/mol. IUPAC name: 4-chloro-[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid. InChIKey: WOZBIMTXLAYVPU-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN4O2 |
|---|---|
| Molecular weight | 248.62 g/mol |
| IUPAC name | 4-chloro-[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid |
| InChIKey | WOZBIMTXLAYVPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(C3=NC(=NN23)C(=O)O)Cl |
Computed by PubChem (NCBI)