Products 1263209-42-2
CAS 1263209-42-2 is the registry number for Methyl 2-(dimethylamino)-6-methylpyrimidine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 10g, 1g.
Methyl 2-(dimethylamino)-6-methylpyrimidine-4-carboxylate (CAS 1263209-42-2) is a chemical compound with the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. IUPAC name: methyl 2-(dimethylamino)-6-methylpyrimidine-4-carboxylate. InChIKey: ITZGBIVNMWZEIV-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | methyl 2-(dimethylamino)-6-methylpyrimidine-4-carboxylate |
| InChIKey | ITZGBIVNMWZEIV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N(C)C)C(=O)OC |
Computed by PubChem (NCBI)