Products 1263280-39-2
CAS 1263280-39-2 is the registry number for 2,2,2-Trifluoro-1-(1H-indol-7-yl)ethanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2,2-trifluoro-1-(1H-indol-7-yl)ethanol (CAS 1263280-39-2) is a chemical compound with the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. IUPAC name: 2,2,2-trifluoro-1-(1H-indol-7-yl)ethanol. InChIKey: OCSJDSSFVBWSFW-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(1H-indol-7-yl)ethanol |
| InChIKey | OCSJDSSFVBWSFW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(C(F)(F)F)O)NC=C2 |
Computed by PubChem (NCBI)