CAS 1263281-77-1 is the registry number for 3-(3,5-Bis(trifluoromethyl)phenyl)pyrrolidine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3,5-bis(trifluoromethyl)phenyl]pyrrolidine;hydrochloride (CAS 1263281-77-1) is a chemical compound with the molecular formula C12H12ClF6N and a molecular weight of 319.67 g/mol. IUPAC name: 3-[3,5-bis(trifluoromethyl)phenyl]pyrrolidine;hydrochloride. InChIKey: VNLKKEBCDNIKQA-UHFFFAOYSA-N.
| Molecular formula | C12H12ClF6N |
|---|---|
| Molecular weight | 319.67 g/mol |
| IUPAC name | 3-[3,5-bis(trifluoromethyl)phenyl]pyrrolidine;hydrochloride |
| InChIKey | VNLKKEBCDNIKQA-UHFFFAOYSA-N |
| SMILES | C1CNCC1C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)