CAS 1263284-43-0 is the registry number for 2–(4–(4–Bromo–phenyl)–1–methyl–1H–imidazol–2–yl)–pyridine. Offered by: GLPBio. Available pack sizes: 200mg.
2-[4-(4-bromophenyl)-1-methylimidazol-2-yl]pyridine (CAS 1263284-43-0) is a chemical compound with the molecular formula C15H12BrN3 and a molecular weight of 314.18 g/mol. IUPAC name: 2-[4-(4-bromophenyl)-1-methylimidazol-2-yl]pyridine. InChIKey: RHCDQKUOKLLODV-UHFFFAOYSA-N.
| Molecular formula | C15H12BrN3 |
|---|---|
| Molecular weight | 314.18 g/mol |
| IUPAC name | 2-[4-(4-bromophenyl)-1-methylimidazol-2-yl]pyridine |
| InChIKey | RHCDQKUOKLLODV-UHFFFAOYSA-N |
| SMILES | CN1C=C(N=C1C2=CC=CC=N2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)