CAS 1263284-59-8 is the registry number for (R)-tert-Butyl 3-(4-Aminophenyl)piperidine-1-carboxylate. Offered by: TRC. Available pack sizes: 1g.
Tert-butyl (3R)-3-(4-aminophenyl)piperidine-1-carboxylate (CAS 1263284-59-8) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 276.37 g/mol. IUPAC name: tert-butyl (3R)-3-(4-aminophenyl)piperidine-1-carboxylate. InChIKey: SWUANUQBXJNXGP-ZDUSSCGKSA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 276.37 g/mol |
| IUPAC name | tert-butyl (3R)-3-(4-aminophenyl)piperidine-1-carboxylate |
| InChIKey | SWUANUQBXJNXGP-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)