CAS 1263314-16-4 is the registry number for 4,6-Dichloro-5-ethyl-2-(methylsulfonyl)pyrimidine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
4,6-dichloro-5-ethyl-2-methylsulfonylpyrimidine (CAS 1263314-16-4) is a chemical compound with the molecular formula C7H8Cl2N2O2S and a molecular weight of 255.12 g/mol. IUPAC name: 4,6-dichloro-5-ethyl-2-methylsulfonylpyrimidine. InChIKey: GHQHLNPDZLZVLB-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O2S |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 4,6-dichloro-5-ethyl-2-methylsulfonylpyrimidine |
| InChIKey | GHQHLNPDZLZVLB-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(N=C1Cl)S(=O)(=O)C)Cl |
Computed by PubChem (NCBI)