CAS 1263361-02-9 is the registry number for Perfluorohexylphosphonic Acid 4-Methylbenzamine. Offered by: TRC. Available pack sizes: 500mg.
4-methylaniline;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylphosphonic acid (CAS 1263361-02-9) is a chemical compound with the molecular formula C13H11F13NO3P and a molecular weight of 507.18 g/mol. IUPAC name: 4-methylaniline;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylphosphonic acid. InChIKey: FGPWDBUGVSWIGE-UHFFFAOYSA-N.
| Molecular formula | C13H11F13NO3P |
|---|---|
| Molecular weight | 507.18 g/mol |
| IUPAC name | 4-methylaniline;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylphosphonic acid |
| InChIKey | FGPWDBUGVSWIGE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N.C(C(C(C(F)(F)P(=O)(O)O)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)