Products 126372-70-1
CAS 126372-70-1 is the registry number for L-CARNITINE-(METHYL-D3) INNER SALT. Offered by: Sigma-Aldrich. Available pack sizes: 10MG.
(3R)-4-[dimethyl(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate (CAS 126372-70-1) is a chemical compound with the molecular formula C7H15NO3 and a molecular weight of 164.22 g/mol. IUPAC name: (3R)-4-[dimethyl(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate. InChIKey: PHIQHXFUZVPYII-IVAVZGRVSA-N.
| Molecular formula | C7H15NO3 |
|---|---|
| Molecular weight | 164.22 g/mol |
| IUPAC name | (3R)-4-[dimethyl(trideuteriomethyl)azaniumyl]-3-hydroxybutanoate |
| InChIKey | PHIQHXFUZVPYII-IVAVZGRVSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)[O-])O |
Computed by PubChem (NCBI)