CAS 1263775-49-0 is the registry number for Rel-(2R,6S)-2,6-dimethyltetrahydropyran-4-ol, 90%, 90%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(2S,6R)-2,6-dimethyloxan-4-ol (CAS 1263775-49-0) is a chemical compound with the molecular formula C7H14O2 and a molecular weight of 130.18 g/mol. IUPAC name: (2S,6R)-2,6-dimethyloxan-4-ol. InChIKey: BHFMWPOZZNNSRV-MEKDEQNOSA-N.
| Molecular formula | C7H14O2 |
|---|---|
| Molecular weight | 130.18 g/mol |
| IUPAC name | (2S,6R)-2,6-dimethyloxan-4-ol |
| InChIKey | BHFMWPOZZNNSRV-MEKDEQNOSA-N |
| SMILES | C[C@@H]1CC(C[C@@H](O1)C)O |
Computed by PubChem (NCBI)