CAS 1264511-67-2 is the registry number for Furo(3,2-c)pyridin-2-ylboronic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Furo[3,2-c]pyridin-2-ylboronic acid (CAS 1264511-67-2) is a chemical compound with the molecular formula C7H6BNO3 and a molecular weight of 162.94 g/mol. IUPAC name: furo[3,2-c]pyridin-2-ylboronic acid. InChIKey: GJLFJOXLBGSLQX-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO3 |
|---|---|
| Molecular weight | 162.94 g/mol |
| IUPAC name | furo[3,2-c]pyridin-2-ylboronic acid |
| InChIKey | GJLFJOXLBGSLQX-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(O1)C=CN=C2)(O)O |
Computed by PubChem (NCBI)