CAS 1264516-00-8 is the registry number for (2,4'–bipyridin)–5–ylboronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
(6-pyridin-4-yl-3-pyridinyl)boronic acid (CAS 1264516-00-8) is a chemical compound with the molecular formula C10H9BN2O2 and a molecular weight of 200.00 g/mol. IUPAC name: (6-pyridin-4-yl-3-pyridinyl)boronic acid. InChIKey: CZPXTJBVLCXRJL-UHFFFAOYSA-N.
| Molecular formula | C10H9BN2O2 |
|---|---|
| Molecular weight | 200.00 g/mol |
| IUPAC name | (6-pyridin-4-yl-3-pyridinyl)boronic acid |
| InChIKey | CZPXTJBVLCXRJL-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)C2=CC=NC=C2)(O)O |
Computed by PubChem (NCBI)