Products 1264743-53-4

CAS 1264743-53-4 is the registry number for trans-2-Iodocyclopropanecarboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Trans-(1S,2R)-2-iodocyclopropane-1-carboxylic acid (CAS 1264743-53-4) is a chemical compound with the molecular formula C4H5IO2 and a molecular weight of 211.99 g/mol. IUPAC name: trans-(1S,2R)-2-iodocyclopropane-1-carboxylic acid. InChIKey: JLDDIEQQVGNSGM-PWNYCUMCSA-N.

Identity
Molecular formulaC4H5IO2
Molecular weight211.99 g/mol
IUPAC nametrans-(1S,2R)-2-iodocyclopropane-1-carboxylic acid
InChIKeyJLDDIEQQVGNSGM-PWNYCUMCSA-N
SMILESC1[C@H]([C@@H]1I)C(=O)O

Computed by PubChem (NCBI)