CAS 126534-35-8 appears in our catalog under these names: (1R)-1-(2,4-Difluorophenyl)ethan-1-ol, 95%, (1R)-1-(2,4-Difluorophenyl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
(1R)-1-(2,4-difluorophenyl)ethanol (CAS 126534-35-8) is a chemical compound with the molecular formula C8H8F2O and a molecular weight of 158.14 g/mol. IUPAC name: (1R)-1-(2,4-difluorophenyl)ethanol. InChIKey: KUBJARHKXBDGAA-RXMQYKEDSA-N.
| Molecular formula | C8H8F2O |
|---|---|
| Molecular weight | 158.14 g/mol |
| IUPAC name | (1R)-1-(2,4-difluorophenyl)ethanol |
| InChIKey | KUBJARHKXBDGAA-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)F)F)O |
Computed by PubChem (NCBI)