Products 126534-37-0
CAS 126534-37-0 appears in our catalog under these names: (1R)-1-(2,5-Difluorophenyl)ethanol, 98%, 98%, (R)-1-(2,5-DIFLUOROPHENYL)ETHAN-1-OL, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R)-1-(2,5-difluorophenyl)ethanol (CAS 126534-37-0) is a chemical compound with the molecular formula C8H8F2O and a molecular weight of 158.14 g/mol. IUPAC name: (1R)-1-(2,5-difluorophenyl)ethanol. InChIKey: RCPAVJXGLFKACE-RXMQYKEDSA-N.
| Molecular formula | C8H8F2O |
|---|---|
| Molecular weight | 158.14 g/mol |
| IUPAC name | (1R)-1-(2,5-difluorophenyl)ethanol |
| InChIKey | RCPAVJXGLFKACE-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)F)F)O |
Computed by PubChem (NCBI)