CAS 126538-86-1 is the registry number for 3-Chloro-4-fluoro-5-iodobenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
1-chloro-2-fluoro-3-iodo-5-(trifluoromethyl)benzene (CAS 126538-86-1) is a chemical compound with the molecular formula C7H2ClF4I and a molecular weight of 324.44 g/mol. IUPAC name: 1-chloro-2-fluoro-3-iodo-5-(trifluoromethyl)benzene. InChIKey: NAWVVUAXVXAEGT-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF4I |
|---|---|
| Molecular weight | 324.44 g/mol |
| IUPAC name | 1-chloro-2-fluoro-3-iodo-5-(trifluoromethyl)benzene |
| InChIKey | NAWVVUAXVXAEGT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)F)I)C(F)(F)F |
Computed by PubChem (NCBI)