CAS 126565-42-2 appears in our catalog under these names: M-Phisyl-chloride, Phthalimidylbenzenesulfonyl chloride. Offered by: Chemat, MedChemExpress. Available pack sizes: 100mg, 500mg, Get quote.
2-methoxy-5-(3-oxo-1H-isoindol-2-yl)benzenesulfonyl chloride (CAS 126565-42-2) is a chemical compound with the molecular formula C15H12ClNO4S and a molecular weight of 337.8 g/mol. IUPAC name: 2-methoxy-5-(3-oxo-1H-isoindol-2-yl)benzenesulfonyl chloride. InChIKey: ABWFLHUIHQOEBX-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO4S |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | 2-methoxy-5-(3-oxo-1H-isoindol-2-yl)benzenesulfonyl chloride |
| InChIKey | ABWFLHUIHQOEBX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N2CC3=CC=CC=C3C2=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)