CAS 126610-77-3 appears in our catalog under these names: Elagolix Impurity 7, Elagolix Impurity 5. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 25mg, 50mg, 100mg, 200mg, 10mg.
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl] 4-methylbenzenesulfonate (CAS 126610-77-3) is a chemical compound with the molecular formula C20H25NO5S and a molecular weight of 391.5 g/mol. IUPAC name: [2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl] 4-methylbenzenesulfonate. InChIKey: XGEQEGQNAGVHDE-UHFFFAOYSA-N.
| Molecular formula | C20H25NO5S |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl] 4-methylbenzenesulfonate |
| InChIKey | XGEQEGQNAGVHDE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C2=CC=CC=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)