CAS 1266226-20-3 appears in our catalog under these names: 3-Amino-8-bromoquinoline dihydrochloride, 95%, 8-Bromoquinolin-3-amine dihydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
8-bromoquinolin-3-amine;dihydrochloride (CAS 1266226-20-3) is a chemical compound with the molecular formula C9H9BrCl2N2 and a molecular weight of 295.99 g/mol. IUPAC name: 8-bromoquinolin-3-amine;dihydrochloride. InChIKey: CVQILHUWBUMKED-UHFFFAOYSA-N.
| Molecular formula | C9H9BrCl2N2 |
|---|---|
| Molecular weight | 295.99 g/mol |
| IUPAC name | 8-bromoquinolin-3-amine;dihydrochloride |
| InChIKey | CVQILHUWBUMKED-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)Br)N.Cl.Cl |
Computed by PubChem (NCBI)