CAS 1266226-28-1 is the registry number for 3-Amino-7-fluoroquinoline dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-fluoroquinolin-3-amine;dihydrochloride (CAS 1266226-28-1) is a chemical compound with the molecular formula C9H9Cl2FN2 and a molecular weight of 235.08 g/mol. IUPAC name: 7-fluoroquinolin-3-amine;dihydrochloride. InChIKey: FUZCMNKLQVFZCS-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2FN2 |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 7-fluoroquinolin-3-amine;dihydrochloride |
| InChIKey | FUZCMNKLQVFZCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)N)F.Cl.Cl |
Computed by PubChem (NCBI)