CAS 126623-65-2 appears in our catalog under these names: 4-Bromo-2-tert-butyl-1,1-dioxo-1,2-dihydroisothiazol-3-one, 95%, 4–Bromo–2–(tert–butyl)isothiazol–3(2H)–one 1,1–dioxide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-bromo-2-tert-butyl-1,1-dioxo-1,2-thiazol-3-one (CAS 126623-65-2) is a chemical compound with the molecular formula C7H10BrNO3S and a molecular weight of 268.13 g/mol. IUPAC name: 4-bromo-2-tert-butyl-1,1-dioxo-1,2-thiazol-3-one. InChIKey: GDUZDXFNMOFVIH-UHFFFAOYSA-N.
| Molecular formula | C7H10BrNO3S |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 4-bromo-2-tert-butyl-1,1-dioxo-1,2-thiazol-3-one |
| InChIKey | GDUZDXFNMOFVIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)C(=CS1(=O)=O)Br |
Computed by PubChem (NCBI)