Products 1266372-35-3

CAS 1266372-35-3 is the registry number for 2-(4-(3-Formyl-2,5-diphenyl-1H-pyrrol-1-yl)phenoxy)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-(3-formyl-2,5-diphenylpyrrol-1-yl)phenoxy]acetic acid (CAS 1266372-35-3) is a chemical compound with the molecular formula C25H19NO4 and a molecular weight of 397.4 g/mol. IUPAC name: 2-[4-(3-formyl-2,5-diphenylpyrrol-1-yl)phenoxy]acetic acid. InChIKey: LMULNIIZBBFQNN-UHFFFAOYSA-N.

Identity
Molecular formulaC25H19NO4
Molecular weight397.4 g/mol
IUPAC name2-[4-(3-formyl-2,5-diphenylpyrrol-1-yl)phenoxy]acetic acid
InChIKeyLMULNIIZBBFQNN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC(=C(N2C3=CC=C(C=C3)OCC(=O)O)C4=CC=CC=C4)C=O

Computed by PubChem (NCBI)