Products 1266398-64-4
CAS 1266398-64-4 appears in our catalog under these names: Fumaric Acid Monoethyl-d5 Ester, Monoethyl fumarate-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
4-oxo-4-(1,1,2,2,2-pentadeuterioethoxy)but-2-enoic acid (CAS 1266398-64-4) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 149.16 g/mol. IUPAC name: 4-oxo-4-(1,1,2,2,2-pentadeuterioethoxy)but-2-enoic acid. InChIKey: XLYMOEINVGRTEX-ZBJDZAJPSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 149.16 g/mol |
| IUPAC name | 4-oxo-4-(1,1,2,2,2-pentadeuterioethoxy)but-2-enoic acid |
| InChIKey | XLYMOEINVGRTEX-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)C=CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fumaric Acid Monoethyl-d5 Ester