CAS 1266615-65-9 is the registry number for 1-Pentanesulfonic acid, sodium salt hydrate, 99%. Offered by: Thermo Scientific (Acros). Available pack sizes: 25g, 100g.
Sodium;pentane-1-sulfonate;hydrate (CAS 1266615-65-9) is a chemical compound with the molecular formula C5H13NaO4S and a molecular weight of 192.21 g/mol. IUPAC name: sodium;pentane-1-sulfonate;hydrate. InChIKey: FPQYXAFKHLSWTI-UHFFFAOYSA-M.
| Molecular formula | C5H13NaO4S |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | sodium;pentane-1-sulfonate;hydrate |
| InChIKey | FPQYXAFKHLSWTI-UHFFFAOYSA-M |
| SMILES | CCCCCS(=O)(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)